C22H22N4O4S — CID 3372354
N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-yloxymethyl)morpholine-4-carbothioamide (PubChem CID 3372354) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-yloxymethyl)morpholine-4-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-yloxymethyl)morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3372354 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-yloxymethyl)morpholine-4-carbothioamide |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)N1CCOC(COc2ncnc3ccccc23)C1 |
| InChI | InChI=1S/C22H22N4O4S/c31-22(23-10-15-5-6-19-20(9-15)30-14-29-19)26-7-8-27-16(11-26)12-28-21-17-3-1-2-4-18(17)24-13-25-21/h1-6,9,13,16H,7-8,10-12,14H2,(H,23,31) |
| InChIKey | CTPANETUMUGBLU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|