C24H26N2O7S — CID 3812632
methyl 3-[4-[[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)morpholin-2-yl]methoxy]phenyl]-3-oxopropanoate (PubChem CID 3812632) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is methyl 3-[4-[[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)morpholin-2-yl]methoxy]phenyl]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)morpholin-2-yl]methoxy]phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 3812632 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | methyl 3-[4-[[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)morpholin-2-yl]methoxy]phenyl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1ccc(OCC2CN(C(=S)NCc3ccc4c(c3)OCO4)CCO2)cc1 |
| InChI | InChI=1S/C24H26N2O7S/c1-29-23(28)11-20(27)17-3-5-18(6-4-17)31-14-19-13-26(8-9-30-19)24(34)25-12-16-2-7-21-22(10-16)33-15-32-21/h2-7,10,19H,8-9,11-15H2,1H3,(H,25,34) |
| InChIKey | YCWXCLOHLFXSCR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|