C19H19NO5 — CID 46156758
[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-phenylmethanone (PubChem CID 46156758) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-phenylmethanone.
| Compound Name | [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46156758 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCOC(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C19H19NO5/c21-19(14-4-2-1-3-5-14)20-8-9-22-16(11-20)12-23-15-6-7-17-18(10-15)25-13-24-17/h1-7,10,16H,8-9,11-13H2 |
| InChIKey | CFXSPVRCLLTLMT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |