C22H24ClNO6 — CID 74229061
1-[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-4-(4-chlorophenoxy)butan-1-one (PubChem CID 74229061) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-4-(4-chlorophenoxy)butan-1-one.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-4-(4-chlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 74229061 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-4-(4-chlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1)N1CCOC(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C22H24ClNO6/c23-16-3-5-17(6-4-16)26-10-1-2-22(25)24-9-11-27-19(13-24)14-28-18-7-8-20-21(12-18)30-15-29-20/h3-8,12,19H,1-2,9-11,13-15H2 |
| InChIKey | WQTKLPBKHLTYIO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|