C18H17BrN2O5 — CID 3740897
[2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-(6-bromo-2-pyridinyl)methanone (PubChem CID 3740897) has the molecular formula C18H17BrN2O5 and a molecular weight of 421.25 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-(6-bromo-2-pyridinyl)methanone.
| Compound Name | [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-(6-bromo-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 3740897 |
| Molecular Formula | C18H17BrN2O5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yloxymethyl)morpholin-4-yl]-(6-bromo-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(Br)n1)N1CCOC(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C18H17BrN2O5/c19-17-3-1-2-14(20-17)18(22)21-6-7-23-13(9-21)10-24-12-4-5-15-16(8-12)26-11-25-15/h1-5,8,13H,6-7,9-11H2 |
| InChIKey | JSDSUTMWLNPJJA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|