C18H16BrF3N2O3 — CID 46100342
(6-bromo-2-pyridinyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone (PubChem CID 46100342) has the molecular formula C18H16BrF3N2O3 and a molecular weight of 445.24 g/mol. Its IUPAC name is (6-bromo-2-pyridinyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone.
| Compound Name | (6-bromo-2-pyridinyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 46100342 |
| Molecular Formula | C18H16BrF3N2O3 |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (6-bromo-2-pyridinyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
| SMILES | O=C(c1cccc(Br)n1)N1CCOC(COc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H16BrF3N2O3/c19-16-6-2-5-15(23-16)17(25)24-7-8-26-14(10-24)11-27-13-4-1-3-12(9-13)18(20,21)22/h1-6,9,14H,7-8,10-11H2 |
| InChIKey | ODNKEIBNXPYFJN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|