C19H18F3NO4 — CID 71846639
[2-(hydroxymethyl)morpholin-4-yl]-[3-[3-(trifluoromethyl)phenoxy]phenyl]methanone (PubChem CID 71846639) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)morpholin-4-yl]-[3-[3-(trifluoromethyl)phenoxy]phenyl]methanone.
| Compound Name | [2-(hydroxymethyl)morpholin-4-yl]-[3-[3-(trifluoromethyl)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 71846639 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-(hydroxymethyl)morpholin-4-yl]-[3-[3-(trifluoromethyl)phenoxy]phenyl]methanone |
| SMILES | O=C(c1cccc(Oc2cccc(C(F)(F)F)c2)c1)N1CCOC(CO)C1 |
| InChI | InChI=1S/C19H18F3NO4/c20-19(21,22)14-4-2-6-16(10-14)27-15-5-1-3-13(9-15)18(25)23-7-8-26-17(11-23)12-24/h1-6,9-10,17,24H,7-8,11-12H2 |
| InChIKey | OBQFFXGMXFLHPD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |