C19H17F4NO3 — CID 71955614
(4-fluorophenyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone (PubChem CID 71955614) has the molecular formula C19H17F4NO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is (4-fluorophenyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 71955614 |
| Molecular Formula | C19H17F4NO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (4-fluorophenyl)-[2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCOC(COc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H17F4NO3/c20-15-6-4-13(5-7-15)18(25)24-8-9-26-17(11-24)12-27-16-3-1-2-14(10-16)19(21,22)23/h1-7,10,17H,8-9,11-12H2 |
| InChIKey | IUCYDKIKPTYXSN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |