C22H24FNO4 — CID 46420143
[2-(4-fluorophenyl)morpholin-4-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone (PubChem CID 46420143) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)morpholin-4-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone.
| Compound Name | [2-(4-fluorophenyl)morpholin-4-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 46420143 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(4-fluorophenyl)morpholin-4-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OCC2CCCO2)c1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H24FNO4/c23-18-8-6-16(7-9-18)21-14-24(10-12-27-21)22(25)17-3-1-4-19(13-17)28-15-20-5-2-11-26-20/h1,3-4,6-9,13,20-21H,2,5,10-12,14-15H2 |
| InChIKey | BPTXKYSEXCSSJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |