C29H32N2O3 — CID 33395478
(4-benzhydrylpiperazin-1-yl)-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]methanone (PubChem CID 33395478) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 33395478 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]methanone |
| SMILES | O=C(c1cccc(OC[C@H]2CCCO2)c1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N2O3/c32-29(25-13-7-14-26(21-25)34-22-27-15-8-20-33-27)31-18-16-30(17-19-31)28(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-7,9-14,21,27-28H,8,15-20,22H2/t27-/m1/s1 |
| InChIKey | LUIHYVQPRQSQRG-HHHXNRCGSA-N |
| XLogP | 4.79 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |