C20H30N2O4 — CID 119662009
[4-(3-aminopropoxy)piperidin-1-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone (PubChem CID 119662009) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 119662009 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(oxolan-2-ylmethoxy)phenyl]methanone |
| SMILES | NCCCOC1CCN(C(=O)c2cccc(OCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C20H30N2O4/c21-9-3-13-24-17-7-10-22(11-8-17)20(23)16-4-1-5-18(14-16)26-15-19-6-2-12-25-19/h1,4-5,14,17,19H,2-3,6-13,15,21H2 |
| InChIKey | VIBSPMNOEYKPJC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|