C20H29Cl2N3O3S — CID 119663690
[4-(3-aminopropoxy)piperidin-1-yl]-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methanone;dihydrochloride (PubChem CID 119663690) has the molecular formula C20H29Cl2N3O3S and a molecular weight of 462.44 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119663690 |
| Molecular Formula | C20H29Cl2N3O3S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methanone;dihydrochloride |
| SMILES | Cc1nc(COc2cccc(C(=O)N3CCC(OCCCN)CC3)c2)cs1.Cl.Cl |
| InChI | InChI=1S/C20H27N3O3S.2ClH/c1-15-22-17(14-27-15)13-26-19-5-2-4-16(12-19)20(24)23-9-6-18(7-10-23)25-11-3-8-21;;/h2,4-5,12,14,18H,3,6-11,13,21H2,1H3;2*1H |
| InChIKey | AFCNIIBZYYSELR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|