C24H27N3O3 — CID 112810509
2-[4-[2-(oxolan-2-ylmethoxy)benzoyl]piperazin-1-yl]-2-phenylacetonitrile (PubChem CID 112810509) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[4-[2-(oxolan-2-ylmethoxy)benzoyl]piperazin-1-yl]-2-phenylacetonitrile.
| Compound Name | 2-[4-[2-(oxolan-2-ylmethoxy)benzoyl]piperazin-1-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 112810509 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[4-[2-(oxolan-2-ylmethoxy)benzoyl]piperazin-1-yl]-2-phenylacetonitrile |
| SMILES | N#CC(c1ccccc1)N1CCN(C(=O)c2ccccc2OCC2CCCO2)CC1 |
| InChI | InChI=1S/C24H27N3O3/c25-17-22(19-7-2-1-3-8-19)26-12-14-27(15-13-26)24(28)21-10-4-5-11-23(21)30-18-20-9-6-16-29-20/h1-5,7-8,10-11,20,22H,6,9,12-16,18H2 |
| InChIKey | NZOGBQNNPOJHRO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |