C12H15NO3 — CID 24633130
2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 24633130) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | 2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 24633130 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | NC(=O)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C12H15NO3/c13-12(14)10-5-1-2-6-11(10)16-8-9-4-3-7-15-9/h1-2,5-6,9H,3-4,7-8H2,(H2,13,14) |
| InChIKey | RCMPBOGPWXFQBV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |