C14H15N3O3S — CID 46445892
2-(oxolan-2-ylmethoxy)-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46445892) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethoxy)-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-(oxolan-2-ylmethoxy)-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46445892 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(oxolan-2-ylmethoxy)-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C14H15N3O3S/c18-13(16-14-17-15-9-21-14)11-5-1-2-6-12(11)20-8-10-4-3-7-19-10/h1-2,5-6,9-10H,3-4,7-8H2,(H,16,17,18) |
| InChIKey | MGYSWHVELAOJMD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |