C17H21NO5 — CID 146076875
methyl (E)-4-[[2-(oxolan-2-ylmethoxy)benzoyl]amino]but-2-enoate (PubChem CID 146076875) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (E)-4-[[2-(oxolan-2-ylmethoxy)benzoyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[2-(oxolan-2-ylmethoxy)benzoyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 146076875 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (E)-4-[[2-(oxolan-2-ylmethoxy)benzoyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C17H21NO5/c1-21-16(19)9-4-10-18-17(20)14-7-2-3-8-15(14)23-12-13-6-5-11-22-13/h2-4,7-9,13H,5-6,10-12H2,1H3,(H,18,20)/b9-4+ |
| InChIKey | QETMHCQKUBKDSK-RUDMXATFSA-N |
| XLogP | 1.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|