C19H20N2O4 — CID 18103402
N-(3-carbamoylphenyl)-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 18103402) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(3-carbamoylphenyl)-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-(3-carbamoylphenyl)-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 18103402 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(3-carbamoylphenyl)-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)c2ccccc2OCC2CCCO2)c1 |
| InChI | InChI=1S/C19H20N2O4/c20-18(22)13-5-3-6-14(11-13)21-19(23)16-8-1-2-9-17(16)25-12-15-7-4-10-24-15/h1-3,5-6,8-9,11,15H,4,7,10,12H2,(H2,20,22)(H,21,23) |
| InChIKey | IXKHEIOMUBPLQN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |