C18H18BrNO3 — CID 41444704
2-bromo-N-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]benzamide (PubChem CID 41444704) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-bromo-N-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]benzamide.
| Compound Name | 2-bromo-N-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 41444704 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-bromo-N-[3-[[(2R)-oxolan-2-yl]methoxy]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)c1ccccc1Br |
| InChI | InChI=1S/C18H18BrNO3/c19-17-9-2-1-8-16(17)18(21)20-13-5-3-6-14(11-13)23-12-15-7-4-10-22-15/h1-3,5-6,8-9,11,15H,4,7,10,12H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | QTUDSLGJIGDNCY-OAHLLOKOSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |