C17H18N2O3S — CID 38477709
N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 38477709) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 38477709 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC[C@@H]2CCCO2)c1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C17H18N2O3S/c20-16(15-7-2-8-18-17(15)23)19-12-4-1-5-13(10-12)22-11-14-6-3-9-21-14/h1-2,4-5,7-8,10,14H,3,6,9,11H2,(H,18,23)(H,19,20)/t14-/m0/s1 |
| InChIKey | WJEQKNPFGDXNAH-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|