C21H21N3O5 — CID 42959580
N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 42959580) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 42959580 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1cccc(N2C(=O)CNC2=O)c1)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C21H21N3O5/c25-19-12-22-21(27)24(19)15-6-3-5-14(11-15)23-20(26)17-8-1-2-9-18(17)29-13-16-7-4-10-28-16/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,22,27)(H,23,26) |
| InChIKey | FQJGBTIMZVNOEA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|