C23H24N2O5S — CID 24534944
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 24534944) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 24534944 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3ccccc3OCC3CCCO3)n2)c1 |
| InChI | InChI=1S/C23H24N2O5S/c1-27-15-9-10-20(28-2)18(12-15)19-14-31-23(24-19)25-22(26)17-7-3-4-8-21(17)30-13-16-6-5-11-29-16/h3-4,7-10,12,14,16H,5-6,11,13H2,1-2H3,(H,24,25,26) |
| InChIKey | FSLUAKGYNPBJDR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |