C20H20N2O5S2 — CID 41028434
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylsulfonylbenzamide (PubChem CID 41028434) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylsulfonylbenzamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 41028434 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nc(-c2cc(OC)ccc2OC)cs1 |
| InChI | InChI=1S/C20H20N2O5S2/c1-4-29(24,25)18-8-6-5-7-14(18)19(23)22-20-21-16(12-28-20)15-11-13(26-2)9-10-17(15)27-3/h5-12H,4H2,1-3H3,(H,21,22,23) |
| InChIKey | KUXCIFYKRMAMCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |