C22H18N2O3S2 — CID 18576995
2-ethylsulfonyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 18576995) has the molecular formula C22H18N2O3S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-ethylsulfonyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18576995 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-ethylsulfonyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C22H18N2O3S2/c1-2-29(26,27)20-10-6-5-9-18(20)21(25)24-22-23-19(14-28-22)17-12-11-15-7-3-4-8-16(15)13-17/h3-14H,2H2,1H3,(H,23,24,25) |
| InChIKey | GCZWQGMXPVCJGH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |