C18H18N2O2S — CID 108733444
butyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 108733444) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is butyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate.
| Compound Name | butyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 108733444 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | butyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C18H18N2O2S/c1-2-3-10-22-18(21)20-17-19-16(12-23-17)15-9-8-13-6-4-5-7-14(13)11-15/h4-9,11-12H,2-3,10H2,1H3,(H,19,20,21) |
| InChIKey | QPLPPGRETRBYQY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|