2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate

C16H13ClN2O2S — CID 108733446

IUPAC2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate
SMILESO=C(Nc1nc(-c2ccc3ccccc3c2)cs1)OCCCl
InChIInChI=1S/C16H13ClN2O2S/c17-7-8-21-16(20)19-15-18-14(10-22-15)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9-10H,7-8H2,(H,18,19,20)
InChIKeyMHNBCCKXEIDMMM-UHFFFAOYSA-N
MW332.81 g/mol
LogP4.75
Rot. Bonds4

About 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate

2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 108733446) has the molecular formula C16H13ClN2O2S and a molecular weight of 332.81 g/mol. Its IUPAC name is 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate.

Molecular Properties

Compound Name2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate
PubChem CID108733446
Molecular FormulaC16H13ClN2O2S
Molecular Weight332.81 g/mol
Exact Mass332.04
IUPAC Name2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate
SMILESO=C(Nc1nc(-c2ccc3ccccc3c2)cs1)OCCCl
InChIInChI=1S/C16H13ClN2O2S/c17-7-8-21-16(20)19-15-18-14(10-22-15)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9-10H,7-8H2,(H,18,19,20)
InChIKeyMHNBCCKXEIDMMM-UHFFFAOYSA-N
XLogP4.75
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.81
LogP ≤ 54.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate (CID 108733446) is 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate is O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)OCCCl.
What is the InChIKey of 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate?
The InChIKey is MHNBCCKXEIDMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O2S/c17-7-8-21-16(20)19-15-18-14(10-22-15)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9-10H,7-8H2,(H,18,19,20).
What are the key properties of 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate?
2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate has a molecular weight of 332.81 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 108733446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).