C10H9ClN2O2S2 — CID 108742123
2-chloroethyl N-(4-thiophen-2-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 108742123) has the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-chloroethyl N-(4-thiophen-2-yl-1,3-thiazol-2-yl)carbamate.
| Compound Name | 2-chloroethyl N-(4-thiophen-2-yl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 108742123 |
| Molecular Formula | C10H9ClN2O2S2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-chloroethyl N-(4-thiophen-2-yl-1,3-thiazol-2-yl)carbamate |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)OCCCl |
| InChI | InChI=1S/C10H9ClN2O2S2/c11-3-4-15-10(14)13-9-12-7(6-17-9)8-2-1-5-16-8/h1-2,5-6H,3-4H2,(H,12,13,14) |
| InChIKey | BVWIDYPSHDHRHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|