C18H17Cl2N3O3S3 — CID 86809667
4-[bis(2-chloroethyl)sulfamoyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 86809667) has the molecular formula C18H17Cl2N3O3S3 and a molecular weight of 490.46 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86809667 |
| Molecular Formula | C18H17Cl2N3O3S3 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)c1ccc(S(=O)(=O)N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O3S3/c19-7-9-23(10-8-20)29(25,26)14-5-3-13(4-6-14)17(24)22-18-21-15(12-28-18)16-2-1-11-27-16/h1-6,11-12H,7-10H2,(H,21,22,24) |
| InChIKey | ZLDWVHWZXOZBCH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|