C21H25N3O4S2 — CID 5066682
4-(dipropylsulfamoyl)-N-[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 5066682) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5066682 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-[4-(5-methylfuran-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(C)o3)cs2)cc1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-4-12-24(13-5-2)30(26,27)17-9-7-16(8-10-17)20(25)23-21-22-18(14-29-21)19-11-6-15(3)28-19/h6-11,14H,4-5,12-13H2,1-3H3,(H,22,23,25) |
| InChIKey | BDOHSTVCOJEEFL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |