C21H29N3O5S2 — CID 3646213
ethyl 2-[[4-(dibutylsulfamoyl)benzoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 3646213) has the molecular formula C21H29N3O5S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is ethyl 2-[[4-(dibutylsulfamoyl)benzoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[4-(dibutylsulfamoyl)benzoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3646213 |
| Molecular Formula | C21H29N3O5S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | ethyl 2-[[4-(dibutylsulfamoyl)benzoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)Nc2nc(C(=O)OCC)cs2)cc1 |
| InChI | InChI=1S/C21H29N3O5S2/c1-4-7-13-24(14-8-5-2)31(27,28)17-11-9-16(10-12-17)19(25)23-21-22-18(15-30-21)20(26)29-6-3/h9-12,15H,4-8,13-14H2,1-3H3,(H,22,23,25) |
| InChIKey | BCYPMXOBVWTLTM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |