C20H27N3O5S2 — CID 5079660
ethyl 2-[2-[[4-[butyl(ethyl)sulfamoyl]benzoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 5079660) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[butyl(ethyl)sulfamoyl]benzoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[4-[butyl(ethyl)sulfamoyl]benzoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 5079660 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 2-[2-[[4-[butyl(ethyl)sulfamoyl]benzoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nc(CC(=O)OCC)cs2)cc1 |
| InChI | InChI=1S/C20H27N3O5S2/c1-4-7-12-23(5-2)30(26,27)17-10-8-15(9-11-17)19(25)22-20-21-16(14-29-20)13-18(24)28-6-3/h8-11,14H,4-7,12-13H2,1-3H3,(H,21,22,25) |
| InChIKey | ONKCLYJOWZRYFE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |