C9H8ClN3O2S2 — CID 108744063
2-chloroethyl N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)carbamate (PubChem CID 108744063) has the molecular formula C9H8ClN3O2S2 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-chloroethyl N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)carbamate.
| Compound Name | 2-chloroethyl N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 108744063 |
| Molecular Formula | C9H8ClN3O2S2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2-chloroethyl N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)carbamate |
| SMILES | O=C(Nc1nnc(-c2cccs2)s1)OCCCl |
| InChI | InChI=1S/C9H8ClN3O2S2/c10-3-4-15-9(14)11-8-13-12-7(17-8)6-2-1-5-16-6/h1-2,5H,3-4H2,(H,11,13,14) |
| InChIKey | NWBRSGUIWABCOA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|