C16H13BrClN3O2S2 — CID 108766421
4-(2-bromo-4-chlorophenoxy)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 108766421) has the molecular formula C16H13BrClN3O2S2 and a molecular weight of 458.79 g/mol. Its IUPAC name is 4-(2-bromo-4-chlorophenoxy)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(2-bromo-4-chlorophenoxy)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 108766421 |
| Molecular Formula | C16H13BrClN3O2S2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | 4-(2-bromo-4-chlorophenoxy)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Br)Nc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C16H13BrClN3O2S2/c17-11-9-10(18)5-6-12(11)23-7-1-4-14(22)19-16-21-20-15(25-16)13-3-2-8-24-13/h2-3,5-6,8-9H,1,4,7H2,(H,19,21,22) |
| InChIKey | RECTZPOPYDYFPC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|