C20H19Cl2N3O3S — CID 3382170
4-(2,4-dichlorophenoxy)-N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 3382170) has the molecular formula C20H19Cl2N3O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 3382170 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | COc1ccc(Cc2nnc(NC(=O)CCCOc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O3S/c1-27-15-7-4-13(5-8-15)11-19-24-25-20(29-19)23-18(26)3-2-10-28-17-9-6-14(21)12-16(17)22/h4-9,12H,2-3,10-11H2,1H3,(H,23,25,26) |
| InChIKey | PCLRRYSHFYRWFB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|