C14H15N3O4S — CID 15916634
butyl N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 15916634) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is butyl N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | butyl N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 15916634 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | butyl N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C14H15N3O4S/c1-2-3-8-21-14(18)16-13-15-12(9-22-13)10-4-6-11(7-5-10)17(19)20/h4-7,9H,2-3,8H2,1H3,(H,15,16,18) |
| InChIKey | OKCCVYCBWQYUHO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|