C12H11ClN2O2S — CID 3624682
ethyl N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 3624682) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is ethyl N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | ethyl N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 3624682 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | ethyl N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-2-17-12(16)15-11-14-10(7-18-11)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3,(H,14,15,16) |
| InChIKey | FTLFCGJITLQSLV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |