C19H18N2O3S2 — CID 7565481
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide (PubChem CID 7565481) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7565481 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-methylsulfonylbenzamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3ccccc3S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C19H18N2O3S2/c1-3-13-8-10-14(11-9-13)16-12-25-19(20-16)21-18(22)15-6-4-5-7-17(15)26(2,23)24/h4-12H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | RNESMYOGWQGNQE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |