C34H34N4O2S2 — CID 5237170
1-N,2-N-bis[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,2-dicarboxamide (PubChem CID 5237170) has the molecular formula C34H34N4O2S2 and a molecular weight of 594.81 g/mol. Its IUPAC name is 1-N,2-N-bis[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 5237170 |
| Molecular Formula | C34H34N4O2S2 |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 1-N,2-N-bis[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,2-dicarboxamide |
| SMILES | CC(C)Cc1ccc(-c2csc(NC(=O)c3ccccc3C(=O)Nc3nc(-c4ccc(CC(C)C)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C34H34N4O2S2/c1-21(2)17-23-9-13-25(14-10-23)29-19-41-33(35-29)37-31(39)27-7-5-6-8-28(27)32(40)38-34-36-30(20-42-34)26-15-11-24(12-16-26)18-22(3)4/h5-16,19-22H,17-18H2,1-4H3,(H,35,37,39)(H,36,38,40) |
| InChIKey | GRHVTPGPOHSYBU-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |