C23H18N2OS2 — CID 41154127
2-methylsulfanyl-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 41154127) has the molecular formula C23H18N2OS2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-methylsulfanyl-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41154127 |
| Molecular Formula | C23H18N2OS2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-methylsulfanyl-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CSc1ccccc1C(=O)Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C23H18N2OS2/c1-27-21-10-6-5-9-19(21)22(26)25-23-24-20(15-28-23)18-13-11-17(12-14-18)16-7-3-2-4-8-16/h2-15H,1H3,(H,24,25,26) |
| InChIKey | RFCHLBNMSRRESY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |