C19H18ClF3N2O3 — CID 92760487
(2-chloro-6-methyl-4-pyridinyl)-[(2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone (PubChem CID 92760487) has the molecular formula C19H18ClF3N2O3 and a molecular weight of 414.81 g/mol. Its IUPAC name is (2-chloro-6-methyl-4-pyridinyl)-[(2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone.
| Compound Name | (2-chloro-6-methyl-4-pyridinyl)-[(2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 92760487 |
| Molecular Formula | C19H18ClF3N2O3 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (2-chloro-6-methyl-4-pyridinyl)-[(2S)-2-[[3-(trifluoromethyl)phenoxy]methyl]morpholin-4-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCO[C@H](COc3cccc(C(F)(F)F)c3)C2)cc(Cl)n1 |
| InChI | InChI=1S/C19H18ClF3N2O3/c1-12-7-13(8-17(20)24-12)18(26)25-5-6-27-16(10-25)11-28-15-4-2-3-14(9-15)19(21,22)23/h2-4,7-9,16H,5-6,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | DCEHIGJOJGHFDS-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|