C20H23NO4 — CID 93327745
[(2R)-2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]-(4-methylphenyl)methanone (PubChem CID 93327745) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(2R)-2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]-(4-methylphenyl)methanone.
| Compound Name | [(2R)-2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 93327745 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [(2R)-2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]-(4-methylphenyl)methanone |
| SMILES | COc1cccc(OC[C@H]2CN(C(=O)c3ccc(C)cc3)CCO2)c1 |
| InChI | InChI=1S/C20H23NO4/c1-15-6-8-16(9-7-15)20(22)21-10-11-24-19(13-21)14-25-18-5-3-4-17(12-18)23-2/h3-9,12,19H,10-11,13-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | BAGIYPDDNQQVHG-LJQANCHMSA-N |
| XLogP | 2.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |