C17H19NO5 — CID 42861355
furan-3-yl-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]methanone (PubChem CID 42861355) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is furan-3-yl-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]methanone.
| Compound Name | furan-3-yl-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 42861355 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | furan-3-yl-[2-[(4-methoxyphenoxy)methyl]morpholin-4-yl]methanone |
| SMILES | COc1ccc(OCC2CN(C(=O)c3ccoc3)CCO2)cc1 |
| InChI | InChI=1S/C17H19NO5/c1-20-14-2-4-15(5-3-14)23-12-16-10-18(7-9-22-16)17(19)13-6-8-21-11-13/h2-6,8,11,16H,7,9-10,12H2,1H3 |
| InChIKey | GDBZVKKBKAVRDI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |