C20H21N3O6S — CID 3691225
methyl 5-[[4-(1,3-benzodioxol-5-ylcarbamothioyl)morpholin-2-yl]methoxy]pyridine-3-carboxylate (PubChem CID 3691225) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is methyl 5-[[4-(1,3-benzodioxol-5-ylcarbamothioyl)morpholin-2-yl]methoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-[[4-(1,3-benzodioxol-5-ylcarbamothioyl)morpholin-2-yl]methoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3691225 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl 5-[[4-(1,3-benzodioxol-5-ylcarbamothioyl)morpholin-2-yl]methoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(OCC2CN(C(=S)Nc3ccc4c(c3)OCO4)CCO2)c1 |
| InChI | InChI=1S/C20H21N3O6S/c1-25-19(24)13-6-15(9-21-8-13)27-11-16-10-23(4-5-26-16)20(30)22-14-2-3-17-18(7-14)29-12-28-17/h2-3,6-9,16H,4-5,10-12H2,1H3,(H,22,30) |
| InChIKey | MZMFFVVXDSSZFK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|