C18H17F3N4O4S — CID 5016479
N-(1,3-benzodioxol-5-yl)-2-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]morpholine-4-carbothioamide (PubChem CID 5016479) has the molecular formula C18H17F3N4O4S and a molecular weight of 442.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]morpholine-4-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 5016479 |
| Molecular Formula | C18H17F3N4O4S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]morpholine-4-carbothioamide |
| SMILES | FC(F)(F)c1nccc(OCC2CN(C(=S)Nc3ccc4c(c3)OCO4)CCO2)n1 |
| InChI | InChI=1S/C18H17F3N4O4S/c19-18(20,21)16-22-4-3-15(24-16)27-9-12-8-25(5-6-26-12)17(30)23-11-1-2-13-14(7-11)29-10-28-13/h1-4,7,12H,5-6,8-10H2,(H,23,30) |
| InChIKey | CSKSAMYUPAECBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|