C21H25F3N4O3S — CID 3714271
2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]-N-[2-(trifluoromethoxy)phenyl]morpholine-4-carbothioamide (PubChem CID 3714271) has the molecular formula C21H25F3N4O3S and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]-N-[2-(trifluoromethoxy)phenyl]morpholine-4-carbothioamide.
| Compound Name | 2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]-N-[2-(trifluoromethoxy)phenyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3714271 |
| Molecular Formula | C21H25F3N4O3S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]-N-[2-(trifluoromethoxy)phenyl]morpholine-4-carbothioamide |
| SMILES | Cc1cc(OCC2CN(C(=S)Nc3ccccc3OC(F)(F)F)CCO2)nc(C(C)C)n1 |
| InChI | InChI=1S/C21H25F3N4O3S/c1-13(2)19-25-14(3)10-18(27-19)30-12-15-11-28(8-9-29-15)20(32)26-16-6-4-5-7-17(16)31-21(22,23)24/h4-7,10,13,15H,8-9,11-12H2,1-3H3,(H,26,32) |
| InChIKey | DNWXLCTXKKBMTG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|