C19H21Cl2N3O4S — CID 3834529
N-(4-chloro-2,5-dimethoxyphenyl)-2-[(2-chloro-3-pyridinyl)oxymethyl]morpholine-4-carbothioamide (PubChem CID 3834529) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[(2-chloro-3-pyridinyl)oxymethyl]morpholine-4-carbothioamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(2-chloro-3-pyridinyl)oxymethyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3834529 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(2-chloro-3-pyridinyl)oxymethyl]morpholine-4-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCOC(COc3cccnc3Cl)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O4S/c1-25-16-9-14(17(26-2)8-13(16)20)23-19(29)24-6-7-27-12(10-24)11-28-15-4-3-5-22-18(15)21/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,23,29) |
| InChIKey | GYGCMBNIHYHGPZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|