C19H19ClN6O3 — CID 3402504
1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 3402504) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 3402504 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[2-[(2-chloro-3-pyridinyl)oxymethyl]morpholin-4-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N1CCOC(COc2cccnc2Cl)C1 |
| InChI | InChI=1S/C19H19ClN6O3/c20-18-16(7-4-8-21-18)29-13-15-11-25(9-10-28-15)17(27)12-26-23-19(22-24-26)14-5-2-1-3-6-14/h1-8,15H,9-13H2 |
| InChIKey | LWTWVYWDCHEZFZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|