C18H18Cl3N3O2S — CID 3765705
2-[(2-chloro-3-pyridinyl)oxymethyl]-N-[(2,4-dichlorophenyl)methyl]morpholine-4-carbothioamide (PubChem CID 3765705) has the molecular formula C18H18Cl3N3O2S and a molecular weight of 446.79 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)oxymethyl]-N-[(2,4-dichlorophenyl)methyl]morpholine-4-carbothioamide.
| Compound Name | 2-[(2-chloro-3-pyridinyl)oxymethyl]-N-[(2,4-dichlorophenyl)methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3765705 |
| Molecular Formula | C18H18Cl3N3O2S |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)oxymethyl]-N-[(2,4-dichlorophenyl)methyl]morpholine-4-carbothioamide |
| SMILES | S=C(NCc1ccc(Cl)cc1Cl)N1CCOC(COc2cccnc2Cl)C1 |
| InChI | InChI=1S/C18H18Cl3N3O2S/c19-13-4-3-12(15(20)8-13)9-23-18(27)24-6-7-25-14(10-24)11-26-16-2-1-5-22-17(16)21/h1-5,8,14H,6-7,9-11H2,(H,23,27) |
| InChIKey | PGQIXIKPWFGMGD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|