C20H17ClF3NO3 — CID 3713766
3-(2-chloro-6-fluorophenyl)-1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]prop-2-en-1-one (PubChem CID 3713766) has the molecular formula C20H17ClF3NO3 and a molecular weight of 411.81 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3713766 |
| Molecular Formula | C20H17ClF3NO3 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1c(F)cccc1Cl)N1CCOC(COc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C20H17ClF3NO3/c21-16-2-1-3-17(23)15(16)5-7-20(26)25-8-9-27-14(11-25)12-28-19-10-13(22)4-6-18(19)24/h1-7,10,14H,8-9,11-12H2 |
| InChIKey | CXLNUTAWQYOYSG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|