C20H19F2NO3S — CID 3700593
1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-phenylsulfanylprop-2-en-1-one (PubChem CID 3700593) has the molecular formula C20H19F2NO3S and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-phenylsulfanylprop-2-en-1-one.
| Compound Name | 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-phenylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 3700593 |
| Molecular Formula | C20H19F2NO3S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-phenylsulfanylprop-2-en-1-one |
| SMILES | O=C(C=CSc1ccccc1)N1CCOC(COc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C20H19F2NO3S/c21-15-6-7-18(22)19(12-15)26-14-16-13-23(9-10-25-16)20(24)8-11-27-17-4-2-1-3-5-17/h1-8,11-12,16H,9-10,13-14H2 |
| InChIKey | MWSRFUATBFMEIV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|