C21H17F6NO3 — CID 3316326
1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 3316326) has the molecular formula C21H17F6NO3 and a molecular weight of 445.36 g/mol. Its IUPAC name is 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3316326 |
| Molecular Formula | C21H17F6NO3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-[2-[(2,5-difluorophenoxy)methyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(F)cc1C(F)(F)F)N1CCOC(COc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C21H17F6NO3/c22-14-3-1-13(17(9-14)21(25,26)27)2-6-20(29)28-7-8-30-16(11-28)12-31-19-10-15(23)4-5-18(19)24/h1-6,9-10,16H,7-8,11-12H2 |
| InChIKey | HPFCBQXIJZPFBG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|